C10H13O3- — CID 5175257
7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 5175257) has the molecular formula C10H13O3- and a molecular weight of 181.21 g/mol. Its IUPAC name is 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 5175257 |
| Molecular Formula | C10H13O3- |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)C2CCC1(C(=O)[O-])C(=O)C2 |
| InChI | InChI=1S/C10H14O3/c1-9(2)6-3-4-10(9,8(12)13)7(11)5-6/h6H,3-5H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | WDODWBQJVMBHCO-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|