C26H23N3O8S — CID 5175616
methyl 2-[3-[hydroxy-(3-propoxyphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5175616) has the molecular formula C26H23N3O8S and a molecular weight of 537.55 g/mol. Its IUPAC name is methyl 2-[3-[hydroxy-(3-propoxyphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[3-[hydroxy-(3-propoxyphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5175616 |
| Molecular Formula | C26H23N3O8S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | methyl 2-[3-[hydroxy-(3-propoxyphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCOc1cccc(C(O)=C2C(=O)C(=O)N(c3nc(C)c(C(=O)OC)s3)C2c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H23N3O8S/c1-4-11-37-18-10-6-8-16(13-18)21(30)19-20(15-7-5-9-17(12-15)29(34)35)28(24(32)22(19)31)26-27-14(2)23(38-26)25(33)36-3/h5-10,12-13,20,30H,4,11H2,1-3H3 |
| InChIKey | IZNFTZOWZLXSCU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|