C17H13ClF3N3O2S — CID 5175730
1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-phenylsulfanylpyrrolidine-2,5-dione (PubChem CID 5175730) has the molecular formula C17H13ClF3N3O2S and a molecular weight of 415.82 g/mol. Its IUPAC name is 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-phenylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-phenylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5175730 |
| Molecular Formula | C17H13ClF3N3O2S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-methylamino]-3-phenylsulfanylpyrrolidine-2,5-dione |
| SMILES | CN(c1ncc(C(F)(F)F)cc1Cl)N1C(=O)CC(Sc2ccccc2)C1=O |
| InChI | InChI=1S/C17H13ClF3N3O2S/c1-23(15-12(18)7-10(9-22-15)17(19,20)21)24-14(25)8-13(16(24)26)27-11-5-3-2-4-6-11/h2-7,9,13H,8H2,1H3 |
| InChIKey | KJZKAKYSODQUNU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|