C24H19FN2O4S — CID 5175804
ethyl 2-[6-fluoro-2-(2-phenoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 5175804) has the molecular formula C24H19FN2O4S and a molecular weight of 450.49 g/mol. Its IUPAC name is ethyl 2-[6-fluoro-2-(2-phenoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-fluoro-2-(2-phenoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5175804 |
| Molecular Formula | C24H19FN2O4S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | ethyl 2-[6-fluoro-2-(2-phenoxybenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccccc2Oc2ccccc2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C24H19FN2O4S/c1-2-30-22(28)15-27-19-13-12-16(25)14-21(19)32-24(27)26-23(29)18-10-6-7-11-20(18)31-17-8-4-3-5-9-17/h3-14H,2,15H2,1H3/b26-24- |
| InChIKey | NZTIQGYLYDYXOU-LCUIJRPUSA-N |
| XLogP | 4.94 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |