C21H21N4PS3 — CID 5175992
10,12-bis(benzylsulfanyl)-10-sulfanylidene-2,7,9,11-tetraza-10λ5-phosphatricyclo[6.4.0.02,6]dodeca-1(8),6,11-triene (PubChem CID 5175992) has the molecular formula C21H21N4PS3 and a molecular weight of 456.60 g/mol. Its IUPAC name is 10,12-bis(benzylsulfanyl)-10-sulfanylidene-2,7,9,11-tetraza-10λ5-phosphatricyclo[6.4.0.02,6]dodeca-1(8),6,11-triene.
| Compound Name | 10,12-bis(benzylsulfanyl)-10-sulfanylidene-2,7,9,11-tetraza-10λ5-phosphatricyclo[6.4.0.02,6]dodeca-1(8),6,11-triene |
|---|---|
| PubChem CID | 5175992 |
| Molecular Formula | C21H21N4PS3 |
| Molecular Weight | 456.60 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 10,12-bis(benzylsulfanyl)-10-sulfanylidene-2,7,9,11-tetraza-10λ5-phosphatricyclo[6.4.0.02,6]dodeca-1(8),6,11-triene |
| SMILES | S=P1(SCc2ccccc2)N=C(SCc2ccccc2)c2c(nc3n2CCC3)N1 |
| InChI | InChI=1S/C21H21N4PS3/c27-26(29-15-17-10-5-2-6-11-17)23-20-19(25-13-7-12-18(25)22-20)21(24-26)28-14-16-8-3-1-4-9-16/h1-6,8-11H,7,12-15H2,(H,23,24,27) |
| InChIKey | IMDXDZIFFWXYBI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|