C16H17NO5S2 — CID 5175993
methyl 7-(3,4-dimethoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate (PubChem CID 5175993) has the molecular formula C16H17NO5S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 7-(3,4-dimethoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate.
| Compound Name | methyl 7-(3,4-dimethoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 5175993 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | methyl 7-(3,4-dimethoxyphenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-6-carboxylate |
| SMILES | COC(=O)C1CSc2[nH]c(=O)sc2C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H17NO5S2/c1-20-10-5-4-8(6-11(10)21-2)12-9(15(18)22-3)7-23-14-13(12)24-16(19)17-14/h4-6,9,12H,7H2,1-3H3,(H,17,19) |
| InChIKey | MTNHKYDMODWZOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|