About N',N'-dimethylethane-1,2-diamine;dihydrochloride
N',N'-dimethylethane-1,2-diamine;dihydrochloride (PubChem CID 517631) has the molecular formula C4H14Cl2N2
and a molecular weight of 161.08 g/mol. Its IUPAC name is N',N'-dimethylethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| PubChem CID | 517631 |
| Molecular Formula | C4H14Cl2N2 |
| Molecular Weight | 161.08 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)CCN.Cl.Cl |
| InChI | InChI=1S/C4H12N2.2ClH/c1-6(2)4-3-5;;/h3-5H2,1-2H3;2*1H |
| InChIKey | PRFNLTCRRYQZOE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.08 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N',N'-dimethylethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The IUPAC name of N',N'-dimethylethane-1,2-diamine;dihydrochloride (CID 517631) is N',N'-dimethylethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N',N'-dimethylethane-1,2-diamine;dihydrochloride is CN(C)CCN.Cl.Cl.
What is the InChIKey of N',N'-dimethylethane-1,2-diamine;dihydrochloride?
The InChIKey is PRFNLTCRRYQZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.2ClH/c1-6(2)4-3-5;;/h3-5H2,1-2H3;2*1H.
What are the key properties of N',N'-dimethylethane-1,2-diamine;dihydrochloride?
N',N'-dimethylethane-1,2-diamine;dihydrochloride has a molecular weight of 161.08 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethylethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 517631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).