About 2-benzoyloxypropyl benzoate
2-benzoyloxypropyl benzoate (PubChem CID 517637) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-benzoyloxypropyl benzoate.
Molecular Properties
| Compound Name | 2-benzoyloxypropyl benzoate |
| PubChem CID | 517637 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-benzoyloxypropyl benzoate |
| SMILES | CC(COC(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O4/c1-13(21-17(19)15-10-6-3-7-11-15)12-20-16(18)14-8-4-2-5-9-14/h2-11,13H,12H2,1H3 |
| InChIKey | UMVMVEZHMZTUHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzoyloxypropyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyloxypropyl benzoate?
The IUPAC name of 2-benzoyloxypropyl benzoate (CID 517637) is 2-benzoyloxypropyl benzoate.
What is the SMILES notation for 2-benzoyloxypropyl benzoate?
The canonical SMILES for 2-benzoyloxypropyl benzoate is CC(COC(=O)c1ccccc1)OC(=O)c1ccccc1.
What is the InChIKey of 2-benzoyloxypropyl benzoate?
The InChIKey is UMVMVEZHMZTUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-13(21-17(19)15-10-6-3-7-11-15)12-20-16(18)14-8-4-2-5-9-14/h2-11,13H,12H2,1H3.
What are the key properties of 2-benzoyloxypropyl benzoate?
2-benzoyloxypropyl benzoate has a molecular weight of 284.31 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyloxypropyl benzoate is sourced from PubChem (CID 517637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).