C32H23Cl2F3N4O5 — CID 5176650
6a-(4-chlorophenyl)-8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5176650) has the molecular formula C32H23Cl2F3N4O5 and a molecular weight of 671.46 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a-(4-chlorophenyl)-8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5176650 |
| Molecular Formula | C32H23Cl2F3N4O5 |
| Molecular Weight | 671.46 g/mol |
| Exact Mass | 670.10 |
| IUPAC Name | 6a-(4-chlorophenyl)-8-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-6-(4-hydroxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1NC(=O)C2C1CC=C1C2CC2C(=O)N(Nc3ncc(C(F)(F)F)cc3Cl)C(=O)C2(c2ccc(Cl)cc2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C32H23Cl2F3N4O5/c33-17-5-3-15(4-6-17)31-22(29(45)41(30(31)46)40-26-23(34)11-16(13-38-26)32(35,36)37)12-21-19(25(31)14-1-7-18(42)8-2-14)9-10-20-24(21)28(44)39-27(20)43/h1-9,11,13,20-22,24-25,42H,10,12H2,(H,38,40)(H,39,43,44) |
| InChIKey | XXNPUQOIXQBECT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|