C13F12 — CID 5177223
1-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 5177223) has the molecular formula C13F12 and a molecular weight of 384.12 g/mol. Its IUPAC name is 1-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 5177223 |
| Molecular Formula | C13F12 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 1-[difluoro-(2,3,4,5,6-pentafluorophenyl)methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13F12/c14-3-1(4(15)8(19)11(22)7(3)18)13(24,25)2-5(16)9(20)12(23)10(21)6(2)17 |
| InChIKey | IHKQBQOJQGQFLU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|