About 2,9-dimethyldecane
2,9-dimethyldecane (PubChem CID 517733) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is 2,9-dimethyldecane.
Molecular Properties
| Compound Name | 2,9-dimethyldecane |
| PubChem CID | 517733 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 2,9-dimethyldecane |
| SMILES | CC(C)CCCCCCC(C)C |
| InChI | InChI=1S/C12H26/c1-11(2)9-7-5-6-8-10-12(3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | HWISDPDDDUZJAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyldecane?
The IUPAC name of 2,9-dimethyldecane (CID 517733) is 2,9-dimethyldecane.
What is the SMILES notation for 2,9-dimethyldecane?
The canonical SMILES for 2,9-dimethyldecane is CC(C)CCCCCCC(C)C.
What is the InChIKey of 2,9-dimethyldecane?
The InChIKey is HWISDPDDDUZJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26/c1-11(2)9-7-5-6-8-10-12(3)4/h11-12H,5-10H2,1-4H3.
What are the key properties of 2,9-dimethyldecane?
2,9-dimethyldecane has a molecular weight of 170.34 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyldecane is sourced from PubChem (CID 517733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).