cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid

C12H13NO3 — CID 51776902

IUPACcis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid
SMILESO=C(NCc1ccccc1)[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C12H13NO3/c14-11(9-6-10(9)12(15)16)13-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,13,14)(H,15,16)/t9-,10+/m0/s1
InChIKeyFUWHNFZMBCQYGY-VHSXEESVSA-N
MW219.24 g/mol
LogP1.02
Rot. Bonds4

About cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid

cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid (PubChem CID 51776902) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid
PubChem CID51776902
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Namecis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid
SMILESO=C(NCc1ccccc1)[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C12H13NO3/c14-11(9-6-10(9)12(15)16)13-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,13,14)(H,15,16)/t9-,10+/m0/s1
InChIKeyFUWHNFZMBCQYGY-VHSXEESVSA-N
XLogP1.02
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid (CID 51776902) is cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid is O=C(NCc1ccccc1)[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid?
The InChIKey is FUWHNFZMBCQYGY-VHSXEESVSA-N. The full InChI is InChI=1S/C12H13NO3/c14-11(9-6-10(9)12(15)16)13-7-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,13,14)(H,15,16)/t9-,10+/m0/s1.
What are the key properties of cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-(benzylcarbamoyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 51776902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).