C18H24N6S2 — CID 5178097
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 3,5-dimethylpiperidine-1-carbodithioate (PubChem CID 5178097) has the molecular formula C18H24N6S2 and a molecular weight of 388.57 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 3,5-dimethylpiperidine-1-carbodithioate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 3,5-dimethylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 5178097 |
| Molecular Formula | C18H24N6S2 |
| Molecular Weight | 388.57 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl 3,5-dimethylpiperidine-1-carbodithioate |
| SMILES | CC1CC(C)CN(C(=S)SCc2nc(N)nc(Nc3ccccc3)n2)C1 |
| InChI | InChI=1S/C18H24N6S2/c1-12-8-13(2)10-24(9-12)18(25)26-11-15-21-16(19)23-17(22-15)20-14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | UGTKQAOGUXSKKV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|