C27H25NO5 — CID 5178176
dimethyl 1-(4-methoxyphenyl)-2,5-diphenyl-2,5-dihydropyrrole-3,4-dicarboxylate (PubChem CID 5178176) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is dimethyl 1-(4-methoxyphenyl)-2,5-diphenyl-2,5-dihydropyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-(4-methoxyphenyl)-2,5-diphenyl-2,5-dihydropyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 5178176 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | dimethyl 1-(4-methoxyphenyl)-2,5-diphenyl-2,5-dihydropyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)N(c2ccc(OC)cc2)C1c1ccccc1 |
| InChI | InChI=1S/C27H25NO5/c1-31-21-16-14-20(15-17-21)28-24(18-10-6-4-7-11-18)22(26(29)32-2)23(27(30)33-3)25(28)19-12-8-5-9-13-19/h4-17,24-25H,1-3H3 |
| InChIKey | RHPRKMPFXMHCCZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|