About 9,10-dioxoanthracene-2,6-disulfonate
9,10-dioxoanthracene-2,6-disulfonate (PubChem CID 5178589) has the molecular formula C14H6O8S2-2
and a molecular weight of 366.33 g/mol. Its IUPAC name is 9,10-dioxoanthracene-2,6-disulfonate.
Molecular Properties
| Compound Name | 9,10-dioxoanthracene-2,6-disulfonate |
| PubChem CID | 5178589 |
| Molecular Formula | C14H6O8S2-2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 9,10-dioxoanthracene-2,6-disulfonate |
| SMILES | O=C1c2ccc(S(=O)(=O)[O-])cc2C(=O)c2ccc(S(=O)(=O)[O-])cc21 |
| InChI | InChI=1S/C14H8O8S2/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)10-4-2-8(6-12(10)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22)/p-2 |
| InChIKey | MSSUFHMGCXOVBZ-UHFFFAOYSA-L |
| XLogP | 0.27 |
| TPSA | 148.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dioxoanthracene-2,6-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dioxoanthracene-2,6-disulfonate?
The IUPAC name of 9,10-dioxoanthracene-2,6-disulfonate (CID 5178589) is 9,10-dioxoanthracene-2,6-disulfonate.
What is the SMILES notation for 9,10-dioxoanthracene-2,6-disulfonate?
The canonical SMILES for 9,10-dioxoanthracene-2,6-disulfonate is O=C1c2ccc(S(=O)(=O)[O-])cc2C(=O)c2ccc(S(=O)(=O)[O-])cc21.
What is the InChIKey of 9,10-dioxoanthracene-2,6-disulfonate?
The InChIKey is MSSUFHMGCXOVBZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H8O8S2/c15-13-9-3-1-7(23(17,18)19)5-11(9)14(16)10-4-2-8(6-12(10)13)24(20,21)22/h1-6H,(H,17,18,19)(H,20,21,22)/p-2.
What are the key properties of 9,10-dioxoanthracene-2,6-disulfonate?
9,10-dioxoanthracene-2,6-disulfonate has a molecular weight of 366.33 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dioxoanthracene-2,6-disulfonate is sourced from PubChem (CID 5178589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).