C4H6 — CID 517868
1,1,4,4-tetradeuteriobuta-1,3-diene (PubChem CID 517868) has the molecular formula C4H6 and a molecular weight of 58.12 g/mol. Its IUPAC name is 1,1,4,4-tetradeuteriobuta-1,3-diene.
| Compound Name | 1,1,4,4-tetradeuteriobuta-1,3-diene |
|---|---|
| PubChem CID | 517868 |
| Molecular Formula | C4H6 |
| Molecular Weight | 58.12 g/mol |
| Exact Mass | 58.07 |
| IUPAC Name | 1,1,4,4-tetradeuteriobuta-1,3-diene |
| SMILES | [2H]C([2H])=CC=C([2H])[2H] |
| InChI | InChI=1S/C4H6/c1-3-4-2/h3-4H,1-2H2/i1D2,2D2 |
| InChIKey | KAKZBPTYRLMSJV-LNLMKGTHSA-N |
| XLogP | 1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 58.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|