About 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene
1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene (PubChem CID 517877) has the molecular formula C13H8Cl4S2
and a molecular weight of 370.15 g/mol. Its IUPAC name is 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene.
Molecular Properties
| Compound Name | 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene |
| PubChem CID | 517877 |
| Molecular Formula | C13H8Cl4S2 |
| Molecular Weight | 370.15 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene |
| SMILES | Clc1ccc(SCSc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C13H8Cl4S2/c14-10-3-1-8(5-12(10)16)18-7-19-9-2-4-11(15)13(17)6-9/h1-6H,7H2 |
| InChIKey | PVURINFQLWSBRK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.15 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene?
The IUPAC name of 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene (CID 517877) is 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene.
What is the SMILES notation for 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene?
The canonical SMILES for 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene is Clc1ccc(SCSc2ccc(Cl)c(Cl)c2)cc1Cl.
What is the InChIKey of 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene?
The InChIKey is PVURINFQLWSBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl4S2/c14-10-3-1-8(5-12(10)16)18-7-19-9-2-4-11(15)13(17)6-9/h1-6H,7H2.
What are the key properties of 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene?
1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene has a molecular weight of 370.15 g/mol, XLogP of 7.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-[(3,4-dichlorophenyl)sulfanylmethylsulfanyl]benzene is sourced from PubChem (CID 517877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).