About bis(trimethylsilyl) benzene-1,3-dicarboxylate
bis(trimethylsilyl) benzene-1,3-dicarboxylate (PubChem CID 517878) has the molecular formula C14H22O4Si2
and a molecular weight of 310.50 g/mol. Its IUPAC name is bis(trimethylsilyl) benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) benzene-1,3-dicarboxylate |
| PubChem CID | 517878 |
| Molecular Formula | C14H22O4Si2 |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | bis(trimethylsilyl) benzene-1,3-dicarboxylate |
| SMILES | C[Si](C)(C)OC(=O)c1cccc(C(=O)O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H22O4Si2/c1-19(2,3)17-13(15)11-8-7-9-12(10-11)14(16)18-20(4,5)6/h7-10H,1-6H3 |
| InChIKey | XBYWPSUAELKTET-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) benzene-1,3-dicarboxylate?
The IUPAC name of bis(trimethylsilyl) benzene-1,3-dicarboxylate (CID 517878) is bis(trimethylsilyl) benzene-1,3-dicarboxylate.
What is the SMILES notation for bis(trimethylsilyl) benzene-1,3-dicarboxylate?
The canonical SMILES for bis(trimethylsilyl) benzene-1,3-dicarboxylate is C[Si](C)(C)OC(=O)c1cccc(C(=O)O[Si](C)(C)C)c1.
What is the InChIKey of bis(trimethylsilyl) benzene-1,3-dicarboxylate?
The InChIKey is XBYWPSUAELKTET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4Si2/c1-19(2,3)17-13(15)11-8-7-9-12(10-11)14(16)18-20(4,5)6/h7-10H,1-6H3.
What are the key properties of bis(trimethylsilyl) benzene-1,3-dicarboxylate?
bis(trimethylsilyl) benzene-1,3-dicarboxylate has a molecular weight of 310.50 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) benzene-1,3-dicarboxylate is sourced from PubChem (CID 517878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).