C17H23N3O3S — CID 5179797
N-(1,3-benzodioxol-5-ylmethyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide (PubChem CID 5179797) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide |
|---|---|
| PubChem CID | 5179797 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4,4,6-trimethyl-2-sulfanylidene-1,3-diazinan-1-yl)acetamide |
| SMILES | CC1CC(C)(C)NC(=S)N1CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H23N3O3S/c1-11-7-17(2,3)19-16(24)20(11)9-15(21)18-8-12-4-5-13-14(6-12)23-10-22-13/h4-6,11H,7-10H2,1-3H3,(H,18,21)(H,19,24) |
| InChIKey | UJVBEXKCDJJMNK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|