About 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol
2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol (PubChem CID 5179799) has the molecular formula C23H19N3O
and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol.
Molecular Properties
| Compound Name | 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol |
| PubChem CID | 5179799 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol |
| SMILES | C=CCc1cccc(/C=N/c2cccn3cc(-c4ccccc4)nc23)c1O |
| InChI | InChI=1S/C23H19N3O/c1-2-8-18-11-6-12-19(22(18)27)15-24-20-13-7-14-26-16-21(25-23(20)26)17-9-4-3-5-10-17/h2-7,9-16,27H,1,8H2/b24-15+ |
| InChIKey | HAMJBWQUARVZFM-BUVRLJJBSA-N |
| XLogP | 5.19 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol?
The IUPAC name of 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol (CID 5179799) is 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol.
What is the SMILES notation for 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol?
The canonical SMILES for 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol is C=CCc1cccc(/C=N/c2cccn3cc(-c4ccccc4)nc23)c1O.
What is the InChIKey of 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol?
The InChIKey is HAMJBWQUARVZFM-BUVRLJJBSA-N. The full InChI is InChI=1S/C23H19N3O/c1-2-8-18-11-6-12-19(22(18)27)15-24-20-13-7-14-26-16-21(25-23(20)26)17-9-4-3-5-10-17/h2-7,9-16,27H,1,8H2/b24-15+.
What are the key properties of 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol?
2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol has a molecular weight of 353.43 g/mol, XLogP of 5.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-phenylimidazo[1,2-a]pyridin-8-yl)iminomethyl]-6-prop-2-enylphenol is sourced from PubChem (CID 5179799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).