About 1-(bromomethyl)-2,3-difluorobenzene
1-(bromomethyl)-2,3-difluorobenzene (PubChem CID 517984) has the molecular formula C7H5BrF2
and a molecular weight of 207.02 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-2,3-difluorobenzene |
| PubChem CID | 517984 |
| Molecular Formula | C7H5BrF2 |
| Molecular Weight | 207.02 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 1-(bromomethyl)-2,3-difluorobenzene |
| SMILES | Fc1cccc(CBr)c1F |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
| InChIKey | FTBSGSZZESQDBM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.02 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-2,3-difluorobenzene?
The IUPAC name of 1-(bromomethyl)-2,3-difluorobenzene (CID 517984) is 1-(bromomethyl)-2,3-difluorobenzene.
What is the SMILES notation for 1-(bromomethyl)-2,3-difluorobenzene?
The canonical SMILES for 1-(bromomethyl)-2,3-difluorobenzene is Fc1cccc(CBr)c1F.
What is the InChIKey of 1-(bromomethyl)-2,3-difluorobenzene?
The InChIKey is FTBSGSZZESQDBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2.
What are the key properties of 1-(bromomethyl)-2,3-difluorobenzene?
1-(bromomethyl)-2,3-difluorobenzene has a molecular weight of 207.02 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-2,3-difluorobenzene is sourced from PubChem (CID 517984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).