C18H15N3OS2 — CID 5179846
2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-thione (PubChem CID 5179846) has the molecular formula C18H15N3OS2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-thione.
| Compound Name | 2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-thione |
|---|---|
| PubChem CID | 5179846 |
| Molecular Formula | C18H15N3OS2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-thione |
| SMILES | S=C1NC2(CS1)Oc1ccccc1C1CC(c3ccccc3)=NN12 |
| InChI | InChI=1S/C18H15N3OS2/c23-17-19-18(11-24-17)21-15(13-8-4-5-9-16(13)22-18)10-14(20-21)12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,19,23) |
| InChIKey | PYQOBJOYXXTDQX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|