About 4-butoxybenzenesulfonyl chloride
4-butoxybenzenesulfonyl chloride (PubChem CID 517990) has the molecular formula C10H13ClO3S
and a molecular weight of 248.73 g/mol. Its IUPAC name is 4-butoxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-butoxybenzenesulfonyl chloride |
| PubChem CID | 517990 |
| Molecular Formula | C10H13ClO3S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 4-butoxybenzenesulfonyl chloride |
| SMILES | CCCCOc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C10H13ClO3S/c1-2-3-8-14-9-4-6-10(7-5-9)15(11,12)13/h4-7H,2-3,8H2,1H3 |
| InChIKey | HGKWMUBXVMFXNC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxybenzenesulfonyl chloride?
The IUPAC name of 4-butoxybenzenesulfonyl chloride (CID 517990) is 4-butoxybenzenesulfonyl chloride.
What is the SMILES notation for 4-butoxybenzenesulfonyl chloride?
The canonical SMILES for 4-butoxybenzenesulfonyl chloride is CCCCOc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-butoxybenzenesulfonyl chloride?
The InChIKey is HGKWMUBXVMFXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3S/c1-2-3-8-14-9-4-6-10(7-5-9)15(11,12)13/h4-7H,2-3,8H2,1H3.
What are the key properties of 4-butoxybenzenesulfonyl chloride?
4-butoxybenzenesulfonyl chloride has a molecular weight of 248.73 g/mol, XLogP of 2.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxybenzenesulfonyl chloride is sourced from PubChem (CID 517990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).