C17H14N4O4 — CID 5180149
1,3-dimethyl-5-[(4-pyrazin-2-yloxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 5180149) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(4-pyrazin-2-yloxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(4-pyrazin-2-yloxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5180149 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1,3-dimethyl-5-[(4-pyrazin-2-yloxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2ccc(Oc3cnccn3)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H14N4O4/c1-20-15(22)13(16(23)21(2)17(20)24)9-11-3-5-12(6-4-11)25-14-10-18-7-8-19-14/h3-10H,1-2H3 |
| InChIKey | FFRDFGDYXDHKLF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|