C25H22N2O4S — CID 5180333
methyl 1-[4-(benzenesulfonyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 5180333) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is methyl 1-[4-(benzenesulfonyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-[4-(benzenesulfonyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 5180333 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | methyl 1-[4-(benzenesulfonyl)phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccc(S(=O)(=O)c3ccccc3)cc2)N1 |
| InChI | InChI=1S/C25H22N2O4S/c1-31-25(28)22-15-20-19-9-5-6-10-21(19)26-24(20)23(27-22)16-11-13-18(14-12-16)32(29,30)17-7-3-2-4-8-17/h2-14,22-23,26-27H,15H2,1H3 |
| InChIKey | CSFUVSXGDVVISN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|