C33H60O6 — CID 518106
tris(2,2,4-trimethylpentyl) cyclohexane-1,2,4-tricarboxylate (PubChem CID 518106) has the molecular formula C33H60O6 and a molecular weight of 552.84 g/mol. Its IUPAC name is tris(2,2,4-trimethylpentyl) cyclohexane-1,2,4-tricarboxylate.
| Compound Name | tris(2,2,4-trimethylpentyl) cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 518106 |
| Molecular Formula | C33H60O6 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | tris(2,2,4-trimethylpentyl) cyclohexane-1,2,4-tricarboxylate |
| SMILES | CC(C)CC(C)(C)COC(=O)C1CCC(C(=O)OCC(C)(C)CC(C)C)C(C(=O)OCC(C)(C)CC(C)C)C1 |
| InChI | InChI=1S/C33H60O6/c1-22(2)16-31(7,8)19-37-28(34)25-13-14-26(29(35)38-20-32(9,10)17-23(3)4)27(15-25)30(36)39-21-33(11,12)18-24(5)6/h22-27H,13-21H2,1-12H3 |
| InChIKey | ZVATUIQDXPRJFN-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|