C16H19N5O3S2 — CID 5181195
N-(1,1-dioxothiolan-3-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 5181195) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5181195 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCS(=O)(=O)C2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C16H19N5O3S2/c1-2-8-21-15(12-3-6-17-7-4-12)19-20-16(21)25-10-14(22)18-13-5-9-26(23,24)11-13/h2-4,6-7,13H,1,5,8-11H2,(H,18,22) |
| InChIKey | SUZNLZIVMAYGRL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|