About triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane
triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane (PubChem CID 518172) has the molecular formula C39H32Si2
and a molecular weight of 556.86 g/mol. Its IUPAC name is triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane.
Molecular Properties
| Compound Name | triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane |
| PubChem CID | 518172 |
| Molecular Formula | C39H32Si2 |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane |
| SMILES | C=C=C([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H32Si2/c1-2-39(40(33-21-9-3-10-22-33,34-23-11-4-12-24-34)35-25-13-5-14-26-35)41(36-27-15-6-16-28-36,37-29-17-7-18-30-37)38-31-19-8-20-32-38/h3-32H,1H2 |
| InChIKey | IBURSJWFICDYSV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane?
The IUPAC name of triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane (CID 518172) is triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane.
What is the SMILES notation for triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane?
The canonical SMILES for triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane is C=C=C([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane?
The InChIKey is IBURSJWFICDYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H32Si2/c1-2-39(40(33-21-9-3-10-22-33,34-23-11-4-12-24-34)35-25-13-5-14-26-35)41(36-27-15-6-16-28-36,37-29-17-7-18-30-37)38-31-19-8-20-32-38/h3-32H,1H2.
What are the key properties of triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane?
triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane has a molecular weight of 556.86 g/mol, XLogP of 5.12, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl(1-triphenylsilylpropa-1,2-dienyl)silane is sourced from PubChem (CID 518172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).