C21H28N4O2S2 — CID 51819691
methyl (2R)-2-[[4-(4-methylquinolin-2-yl)piperazine-1-carbothioyl]amino]-4-methylsulfanylbutanoate (PubChem CID 51819691) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is methyl (2R)-2-[[4-(4-methylquinolin-2-yl)piperazine-1-carbothioyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[4-(4-methylquinolin-2-yl)piperazine-1-carbothioyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51819691 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl (2R)-2-[[4-(4-methylquinolin-2-yl)piperazine-1-carbothioyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](CCSC)NC(=S)N1CCN(c2cc(C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C21H28N4O2S2/c1-15-14-19(22-17-7-5-4-6-16(15)17)24-9-11-25(12-10-24)21(28)23-18(8-13-29-3)20(26)27-2/h4-7,14,18H,8-13H2,1-3H3,(H,23,28)/t18-/m1/s1 |
| InChIKey | LYPITUPPHKRVNS-GOSISDBHSA-N |
| XLogP | 2.83 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|