About N,N-dihexyl-3,6-dimethylpyrazin-2-amine
N,N-dihexyl-3,6-dimethylpyrazin-2-amine (PubChem CID 518224) has the molecular formula C18H33N3
and a molecular weight of 291.48 g/mol. Its IUPAC name is N,N-dihexyl-3,6-dimethylpyrazin-2-amine.
Molecular Properties
| Compound Name | N,N-dihexyl-3,6-dimethylpyrazin-2-amine |
| PubChem CID | 518224 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N,N-dihexyl-3,6-dimethylpyrazin-2-amine |
| SMILES | CCCCCCN(CCCCCC)c1nc(C)cnc1C |
| InChI | InChI=1S/C18H33N3/c1-5-7-9-11-13-21(14-12-10-8-6-2)18-17(4)19-15-16(3)20-18/h15H,5-14H2,1-4H3 |
| InChIKey | JVJBAKXUBKDZNQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihexyl-3,6-dimethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihexyl-3,6-dimethylpyrazin-2-amine?
The IUPAC name of N,N-dihexyl-3,6-dimethylpyrazin-2-amine (CID 518224) is N,N-dihexyl-3,6-dimethylpyrazin-2-amine.
What is the SMILES notation for N,N-dihexyl-3,6-dimethylpyrazin-2-amine?
The canonical SMILES for N,N-dihexyl-3,6-dimethylpyrazin-2-amine is CCCCCCN(CCCCCC)c1nc(C)cnc1C.
What is the InChIKey of N,N-dihexyl-3,6-dimethylpyrazin-2-amine?
The InChIKey is JVJBAKXUBKDZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3/c1-5-7-9-11-13-21(14-12-10-8-6-2)18-17(4)19-15-16(3)20-18/h15H,5-14H2,1-4H3.
What are the key properties of N,N-dihexyl-3,6-dimethylpyrazin-2-amine?
N,N-dihexyl-3,6-dimethylpyrazin-2-amine has a molecular weight of 291.48 g/mol, XLogP of 5.06, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihexyl-3,6-dimethylpyrazin-2-amine is sourced from PubChem (CID 518224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).