C29H35N3O7 — CID 5182713
2-[4-[3-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide (PubChem CID 5182713) has the molecular formula C29H35N3O7 and a molecular weight of 537.61 g/mol. Its IUPAC name is 2-[4-[3-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[3-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 5182713 |
| Molecular Formula | C29H35N3O7 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-[4-[3-[hydroxy-(2-methyl-4-propan-2-yloxyphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-4,5-dioxopyrrolidin-2-yl]phenoxy]acetamide |
| SMILES | Cc1cc(OC(C)C)ccc1C(O)=C1C(=O)C(=O)N(CCN2CCOCC2)C1c1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C29H35N3O7/c1-18(2)39-22-8-9-23(19(3)16-22)27(34)25-26(20-4-6-21(7-5-20)38-17-24(30)33)32(29(36)28(25)35)11-10-31-12-14-37-15-13-31/h4-9,16,18,26,34H,10-15,17H2,1-3H3,(H2,30,33) |
| InChIKey | RQRXZBOHXZSPQH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|