C20H18BrNO2 — CID 5182854
8-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde (PubChem CID 5182854) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is 8-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde.
| Compound Name | 8-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
|---|---|
| PubChem CID | 5182854 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 8-bromo-1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(C=O)cc(Br)c1O2 |
| InChI | InChI=1S/C20H18BrNO2/c1-19(2)15-6-4-5-7-17(15)22(3)20(19)9-8-14-10-13(12-23)11-16(21)18(14)24-20/h4-12H,1-3H3 |
| InChIKey | CDTMSUARDNMJCC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|