C25H27N7O3 — CID 5182973
(4-pyrimidin-2-ylpiperazin-1-yl)-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone (PubChem CID 5182973) has the molecular formula C25H27N7O3 and a molecular weight of 473.54 g/mol. Its IUPAC name is (4-pyrimidin-2-ylpiperazin-1-yl)-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone.
| Compound Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone |
|---|---|
| PubChem CID | 5182973 |
| Molecular Formula | C25H27N7O3 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (4-pyrimidin-2-ylpiperazin-1-yl)-(12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-1-yl)methanone |
| SMILES | CC12CCC(C(=O)N3CCN(c4ncccn4)CC3)(c3nc4cc([N+](=O)[O-])ccc4nc31)C2(C)C |
| InChI | InChI=1S/C25H27N7O3/c1-23(2)24(3)7-8-25(23,20-19(24)28-17-6-5-16(32(34)35)15-18(17)29-20)21(33)30-11-13-31(14-12-30)22-26-9-4-10-27-22/h4-6,9-10,15H,7-8,11-14H2,1-3H3 |
| InChIKey | AOXDUQPXMLZOLS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 118.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|