C26H18F2N2O6 — CID 5183358
[4-[[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-[(2-fluorobenzoyl)amino]acetate (PubChem CID 5183358) has the molecular formula C26H18F2N2O6 and a molecular weight of 492.43 g/mol. Its IUPAC name is [4-[[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-[(2-fluorobenzoyl)amino]acetate.
| Compound Name | [4-[[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-[(2-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 5183358 |
| Molecular Formula | C26H18F2N2O6 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [4-[[2-(2-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 2-[(2-fluorobenzoyl)amino]acetate |
| SMILES | COc1cc(C=C2N=C(c3ccccc3F)OC2=O)ccc1OC(=O)CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C26H18F2N2O6/c1-34-22-13-15(12-20-26(33)36-25(30-20)17-7-3-5-9-19(17)28)10-11-21(22)35-23(31)14-29-24(32)16-6-2-4-8-18(16)27/h2-13H,14H2,1H3,(H,29,32) |
| InChIKey | RDAMKZJFXXTIMG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|