C21H23N3O6 — CID 51837621
3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 51837621) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 51837621 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-[(3R)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)CC[C@H]2NC(=O)c3ccccc3NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O6/c1-28-16-10-12(11-17(29-2)19(16)30-3)22-18(25)9-8-15-21(27)23-14-7-5-4-6-13(14)20(26)24-15/h4-7,10-11,15H,8-9H2,1-3H3,(H,22,25)(H,23,27)(H,24,26)/t15-/m1/s1 |
| InChIKey | UCQOQWYXVZZKTF-OAHLLOKOSA-N |
| XLogP | 2.18 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |