About N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide
N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide (PubChem CID 5183904) has the molecular formula C27H27N3OS
and a molecular weight of 441.60 g/mol. Its IUPAC name is N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide |
| PubChem CID | 5183904 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(-c2ccccc2)s/c(=N\c2ccccc2)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C27H27N3OS/c1-4-29(5-2)26(31)24-25(21-12-8-6-9-13-21)32-27(28-22-14-10-7-11-15-22)30(24)23-18-16-20(3)17-19-23/h6-19H,4-5H2,1-3H3/b28-27- |
| InChIKey | GBUJKZFMFMWEDI-DQSJHHFOSA-N |
| XLogP | 6.23 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide?
The IUPAC name of N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide (CID 5183904) is N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide?
The canonical SMILES for N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide is CCN(CC)C(=O)c1c(-c2ccccc2)s/c(=N\c2ccccc2)n1-c1ccc(C)cc1.
What is the InChIKey of N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide?
The InChIKey is GBUJKZFMFMWEDI-DQSJHHFOSA-N. The full InChI is InChI=1S/C27H27N3OS/c1-4-29(5-2)26(31)24-25(21-12-8-6-9-13-21)32-27(28-22-14-10-7-11-15-22)30(24)23-18-16-20(3)17-19-23/h6-19H,4-5H2,1-3H3/b28-27-.
What are the key properties of N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide?
N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide has a molecular weight of 441.60 g/mol, XLogP of 6.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-(4-methylphenyl)-5-phenyl-2-phenylimino-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 5183904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).