C8H11N5 — CID 5185008
5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine (PubChem CID 5185008) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine.
| Compound Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine |
|---|---|
| PubChem CID | 5185008 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5,7-dimethylpyrazolo[1,5-a]pyrimidine-2,3-diamine |
| SMILES | Cc1cc(C)n2nc(N)c(N)c2n1 |
| InChI | InChI=1S/C8H11N5/c1-4-3-5(2)13-8(11-4)6(9)7(10)12-13/h3H,9H2,1-2H3,(H2,10,12) |
| InChIKey | UWPZIUVTJBGBCD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |