C15H9Cl5N4O2S — CID 51851855
(Z)-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine (PubChem CID 51851855) has the molecular formula C15H9Cl5N4O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is (Z)-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine.
| Compound Name | (Z)-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine |
|---|---|
| PubChem CID | 51851855 |
| Molecular Formula | C15H9Cl5N4O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 483.89 |
| IUPAC Name | (Z)-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine |
| SMILES | CSc1nncn1/N=C\c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C15H9Cl5N4O2S/c1-27-15-23-21-6-24(15)22-4-7-2-3-8(26-7)5-25-14-12(19)10(17)9(16)11(18)13(14)20/h2-4,6H,5H2,1H3/b22-4- |
| InChIKey | PQETXUNHGDJIDX-OZDWGKQUSA-N |
| XLogP | 6.32 |
| TPSA | 65.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|