C23H22N6O3 — CID 51855374
5-(3-nitrophenyl)-N-[(1R)-1-(4-propylphenyl)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 51855374) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-N-[(1R)-1-(4-propylphenyl)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | 5-(3-nitrophenyl)-N-[(1R)-1-(4-propylphenyl)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 51855374 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-(3-nitrophenyl)-N-[(1R)-1-(4-propylphenyl)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | CCCc1ccc([C@@H](C)NC(=O)c2cc(-c3cccc([N+](=O)[O-])c3)nc3ncnn23)cc1 |
| InChI | InChI=1S/C23H22N6O3/c1-3-5-16-8-10-17(11-9-16)15(2)26-22(30)21-13-20(27-23-24-14-25-28(21)23)18-6-4-7-19(12-18)29(31)32/h4,6-15H,3,5H2,1-2H3,(H,26,30)/t15-/m1/s1 |
| InChIKey | OPERIWRIDLTKQX-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|