C22H23NO5 — CID 51855524
(5S)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-propylpyrrolidine-2,3-dione (PubChem CID 51855524) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (5S)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-propylpyrrolidine-2,3-dione.
| Compound Name | (5S)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 51855524 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (5S)-5-(3,4-dimethoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H23NO5/c1-4-12-23-19(15-10-11-16(27-2)17(13-15)28-3)18(21(25)22(23)26)20(24)14-8-6-5-7-9-14/h5-11,13,19,24H,4,12H2,1-3H3/t19-/m0/s1 |
| InChIKey | ZZKPQEWEJGGHDR-IBGZPJMESA-N |
| XLogP | 3.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|