C18H18ClFN2O — CID 51856360
(2S)-N-(2-chloro-4-methylphenyl)-2-(4-fluorophenyl)pyrrolidine-1-carboxamide (PubChem CID 51856360) has the molecular formula C18H18ClFN2O and a molecular weight of 332.81 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-methylphenyl)-2-(4-fluorophenyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(2-chloro-4-methylphenyl)-2-(4-fluorophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51856360 |
| Molecular Formula | C18H18ClFN2O |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (2S)-N-(2-chloro-4-methylphenyl)-2-(4-fluorophenyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC[C@H]2c2ccc(F)cc2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2O/c1-12-4-9-16(15(19)11-12)21-18(23)22-10-2-3-17(22)13-5-7-14(20)8-6-13/h4-9,11,17H,2-3,10H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | PWNRLWLQWWARLZ-KRWDZBQOSA-N |
| XLogP | 5.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |