C17H14Cl2N2O3 — CID 51860115
(3S)-3-(3,4-dichloroanilino)-1-(3-methoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 51860115) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is (3S)-3-(3,4-dichloroanilino)-1-(3-methoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(3,4-dichloroanilino)-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51860115 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | (3S)-3-(3,4-dichloroanilino)-1-(3-methoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C[C@H](Nc3ccc(Cl)c(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-24-12-4-2-3-11(8-12)21-16(22)9-15(17(21)23)20-10-5-6-13(18)14(19)7-10/h2-8,15,20H,9H2,1H3/t15-/m0/s1 |
| InChIKey | BURGTDZJYJZZFM-HNNXBMFYSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|