C17H21FN2O3S2 — CID 51860865
(2R)-N-[(3aR,6aR)-3-[(4-fluorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide (PubChem CID 51860865) has the molecular formula C17H21FN2O3S2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (2R)-N-[(3aR,6aR)-3-[(4-fluorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide.
| Compound Name | (2R)-N-[(3aR,6aR)-3-[(4-fluorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide |
|---|---|
| PubChem CID | 51860865 |
| Molecular Formula | C17H21FN2O3S2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2R)-N-[(3aR,6aR)-3-[(4-fluorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN2O3S2/c1-3-11(2)16(21)19-17-20(8-12-4-6-13(18)7-5-12)14-9-25(22,23)10-15(14)24-17/h4-7,11,14-15H,3,8-10H2,1-2H3/b19-17-/t11-,14-,15+/m1/s1 |
| InChIKey | IQPWPIBQQONSPO-PKYJRORGSA-N |
| XLogP | 2.47 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|