C11H18N2O2 — CID 51863667
(2R)-1-(4-aminophenoxy)-3-(dimethylamino)propan-2-ol (PubChem CID 51863667) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (2R)-1-(4-aminophenoxy)-3-(dimethylamino)propan-2-ol.
| Compound Name | (2R)-1-(4-aminophenoxy)-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 51863667 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2R)-1-(4-aminophenoxy)-3-(dimethylamino)propan-2-ol |
| SMILES | CN(C)C[C@@H](O)COc1ccc(N)cc1 |
| InChI | InChI=1S/C11H18N2O2/c1-13(2)7-10(14)8-15-11-5-3-9(12)4-6-11/h3-6,10,14H,7-8,12H2,1-2H3/t10-/m1/s1 |
| InChIKey | BOYVZXJHUROLHZ-SNVBAGLBSA-N |
| XLogP | 0.57 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|