About [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate
[2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate (PubChem CID 5186521) has the molecular formula C23H22N2O3
and a molecular weight of 374.44 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate |
| PubChem CID | 5186521 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1ccccc1Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c1-17(18-10-4-2-5-11-18)24-22(26)16-28-23(27)20-14-8-9-15-21(20)25-19-12-6-3-7-13-19/h2-15,17,25H,16H2,1H3,(H,24,26) |
| InChIKey | XVCRVBNDLGOWSW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate?
The IUPAC name of [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate (CID 5186521) is [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate.
What is the SMILES notation for [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate?
The canonical SMILES for [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate is CC(NC(=O)COC(=O)c1ccccc1Nc1ccccc1)c1ccccc1.
What is the InChIKey of [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate?
The InChIKey is XVCRVBNDLGOWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O3/c1-17(18-10-4-2-5-11-18)24-22(26)16-28-23(27)20-14-8-9-15-21(20)25-19-12-6-3-7-13-19/h2-15,17,25H,16H2,1H3,(H,24,26).
What are the key properties of [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate?
[2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate has a molecular weight of 374.44 g/mol, XLogP of 4.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1-phenylethylamino)ethyl] 2-anilinobenzoate is sourced from PubChem (CID 5186521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).