C22H30N2O3S — CID 51866648
2,4,5-trimethyl-N-[3-[(2S)-2-phenylmorpholin-4-yl]propyl]benzenesulfonamide (PubChem CID 51866648) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-[3-[(2S)-2-phenylmorpholin-4-yl]propyl]benzenesulfonamide.
| Compound Name | 2,4,5-trimethyl-N-[3-[(2S)-2-phenylmorpholin-4-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51866648 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2,4,5-trimethyl-N-[3-[(2S)-2-phenylmorpholin-4-yl]propyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCCN2CCO[C@@H](c3ccccc3)C2)cc1C |
| InChI | InChI=1S/C22H30N2O3S/c1-17-14-19(3)22(15-18(17)2)28(25,26)23-10-7-11-24-12-13-27-21(16-24)20-8-5-4-6-9-20/h4-6,8-9,14-15,21,23H,7,10-13,16H2,1-3H3/t21-/m1/s1 |
| InChIKey | FBWLSNKCVWKCRT-OAQYLSRUSA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|