C21H28N4O3 — CID 51868113
(2R)-2-(2,5-dimethylphenoxy)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]propanamide (PubChem CID 51868113) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethylphenoxy)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]propanamide.
| Compound Name | (2R)-2-(2,5-dimethylphenoxy)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]propanamide |
|---|---|
| PubChem CID | 51868113 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (2R)-2-(2,5-dimethylphenoxy)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)oxyethyl]propanamide |
| SMILES | Cc1ccc(C)c(O[C@H](C)C(=O)NCCOc2cc(N3CCCC3)ncn2)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-15-6-7-16(2)18(12-15)28-17(3)21(26)22-8-11-27-20-13-19(23-14-24-20)25-9-4-5-10-25/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | FGTHIBCPGLBHMT-QGZVFWFLSA-N |
| XLogP | 2.66 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|