C21H18ClN3O2 — CID 51868467
(3R)-1-(4-chlorophenyl)-N-(2-methylquinolin-5-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 51868467) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-N-(2-methylquinolin-5-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-chlorophenyl)-N-(2-methylquinolin-5-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51868467 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-N-(2-methylquinolin-5-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc2c(NC(=O)[C@@H]3CC(=O)N(c4ccc(Cl)cc4)C3)cccc2n1 |
| InChI | InChI=1S/C21H18ClN3O2/c1-13-5-10-17-18(23-13)3-2-4-19(17)24-21(27)14-11-20(26)25(12-14)16-8-6-15(22)7-9-16/h2-10,14H,11-12H2,1H3,(H,24,27)/t14-/m1/s1 |
| InChIKey | KPHDFMADDLOIKJ-CQSZACIVSA-N |
| XLogP | 4.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |