C8H7NS2 — CID 5186862
4-methyl-2-thiophen-2-yl-1,3-thiazole (PubChem CID 5186862) has the molecular formula C8H7NS2 and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-methyl-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-methyl-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 5186862 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 4-methyl-2-thiophen-2-yl-1,3-thiazole |
| SMILES | Cc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C8H7NS2/c1-6-5-11-8(9-6)7-3-2-4-10-7/h2-5H,1H3 |
| InChIKey | JFNMEDQHLIJSKA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |