About N-ethylbutanamide
N-ethylbutanamide (PubChem CID 518695) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is N-ethylbutanamide.
Molecular Properties
| Compound Name | N-ethylbutanamide |
| PubChem CID | 518695 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | N-ethylbutanamide |
| SMILES | CCCC(=O)NCC |
| InChI | InChI=1S/C6H13NO/c1-3-5-6(8)7-4-2/h3-5H2,1-2H3,(H,7,8) |
| InChIKey | DHCJWWQFOMHARO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylbutanamide?
The IUPAC name of N-ethylbutanamide (CID 518695) is N-ethylbutanamide.
What is the SMILES notation for N-ethylbutanamide?
The canonical SMILES for N-ethylbutanamide is CCCC(=O)NCC.
What is the InChIKey of N-ethylbutanamide?
The InChIKey is DHCJWWQFOMHARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-3-5-6(8)7-4-2/h3-5H2,1-2H3,(H,7,8).
What are the key properties of N-ethylbutanamide?
N-ethylbutanamide has a molecular weight of 115.18 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylbutanamide is sourced from PubChem (CID 518695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).